About methyl 3-methylsulfonylbenzoate
methyl 3-methylsulfonylbenzoate (PubChem CID 6432252) has the molecular formula C9H10O4S
and a molecular weight of 214.24 g/mol. Its IUPAC name is methyl 3-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | methyl 3-methylsulfonylbenzoate |
| PubChem CID | 6432252 |
| Molecular Formula | C9H10O4S |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | methyl 3-methylsulfonylbenzoate |
| SMILES | COC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C9H10O4S/c1-13-9(10)7-4-3-5-8(6-7)14(2,11)12/h3-6H,1-2H3 |
| InChIKey | QJLLSNKBORJJHO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methylsulfonylbenzoate?
The IUPAC name of methyl 3-methylsulfonylbenzoate (CID 6432252) is methyl 3-methylsulfonylbenzoate.
What is the SMILES notation for methyl 3-methylsulfonylbenzoate?
The canonical SMILES for methyl 3-methylsulfonylbenzoate is COC(=O)c1cccc(S(C)(=O)=O)c1.
What is the InChIKey of methyl 3-methylsulfonylbenzoate?
The InChIKey is QJLLSNKBORJJHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O4S/c1-13-9(10)7-4-3-5-8(6-7)14(2,11)12/h3-6H,1-2H3.
What are the key properties of methyl 3-methylsulfonylbenzoate?
methyl 3-methylsulfonylbenzoate has a molecular weight of 214.24 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methylsulfonylbenzoate is sourced from PubChem (CID 6432252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).