About tert-butyl 3-methylsulfonylbenzoate
tert-butyl 3-methylsulfonylbenzoate (PubChem CID 59539564) has the molecular formula C12H16O4S
and a molecular weight of 256.32 g/mol. Its IUPAC name is tert-butyl 3-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | tert-butyl 3-methylsulfonylbenzoate |
| PubChem CID | 59539564 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | tert-butyl 3-methylsulfonylbenzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H16O4S/c1-12(2,3)16-11(13)9-6-5-7-10(8-9)17(4,14)15/h5-8H,1-4H3 |
| InChIKey | IRAZRISMKZHKIO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 3-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-methylsulfonylbenzoate?
The IUPAC name of tert-butyl 3-methylsulfonylbenzoate (CID 59539564) is tert-butyl 3-methylsulfonylbenzoate.
What is the SMILES notation for tert-butyl 3-methylsulfonylbenzoate?
The canonical SMILES for tert-butyl 3-methylsulfonylbenzoate is CC(C)(C)OC(=O)c1cccc(S(C)(=O)=O)c1.
What is the InChIKey of tert-butyl 3-methylsulfonylbenzoate?
The InChIKey is IRAZRISMKZHKIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4S/c1-12(2,3)16-11(13)9-6-5-7-10(8-9)17(4,14)15/h5-8H,1-4H3.
What are the key properties of tert-butyl 3-methylsulfonylbenzoate?
tert-butyl 3-methylsulfonylbenzoate has a molecular weight of 256.32 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-methylsulfonylbenzoate is sourced from PubChem (CID 59539564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).