C15H22O5S — CID 23158729
tert-butyl 3-(3-methylsulfonyloxypropyl)benzoate (PubChem CID 23158729) has the molecular formula C15H22O5S and a molecular weight of 314.40 g/mol. Its IUPAC name is tert-butyl 3-(3-methylsulfonyloxypropyl)benzoate.
| Compound Name | tert-butyl 3-(3-methylsulfonyloxypropyl)benzoate |
|---|---|
| PubChem CID | 23158729 |
| Molecular Formula | C15H22O5S |
| Molecular Weight | 314.40 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | tert-butyl 3-(3-methylsulfonyloxypropyl)benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(CCCOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H22O5S/c1-15(2,3)20-14(16)13-9-5-7-12(11-13)8-6-10-19-21(4,17)18/h5,7,9,11H,6,8,10H2,1-4H3 |
| InChIKey | YDZQSZHPAAUQKW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.40 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|