C15H22O6S — CID 58857421
ethyl 2-[3-(3-methylsulfonyloxypropyl)phenoxy]propanoate (PubChem CID 58857421) has the molecular formula C15H22O6S and a molecular weight of 330.40 g/mol. Its IUPAC name is ethyl 2-[3-(3-methylsulfonyloxypropyl)phenoxy]propanoate.
| Compound Name | ethyl 2-[3-(3-methylsulfonyloxypropyl)phenoxy]propanoate |
|---|---|
| PubChem CID | 58857421 |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl 2-[3-(3-methylsulfonyloxypropyl)phenoxy]propanoate |
| SMILES | CCOC(=O)C(C)Oc1cccc(CCCOS(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H22O6S/c1-4-19-15(16)12(2)21-14-9-5-7-13(11-14)8-6-10-20-22(3,17)18/h5,7,9,11-12H,4,6,8,10H2,1-3H3 |
| InChIKey | LDDZLWJBSPCWGM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|