C18H22O4S — CID 166852180
2-[3-(3-phenylpropoxy)phenyl]ethyl methanesulfonate (PubChem CID 166852180) has the molecular formula C18H22O4S and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-[3-(3-phenylpropoxy)phenyl]ethyl methanesulfonate.
| Compound Name | 2-[3-(3-phenylpropoxy)phenyl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 166852180 |
| Molecular Formula | C18H22O4S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | 2-[3-(3-phenylpropoxy)phenyl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1cccc(OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C18H22O4S/c1-23(19,20)22-14-12-17-9-5-11-18(15-17)21-13-6-10-16-7-3-2-4-8-16/h2-5,7-9,11,15H,6,10,12-14H2,1H3 |
| InChIKey | BJKIHCDCGIWMJA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|