C27H31NO6S — CID 91547279
2-[benzyl-[[3-[2-(3-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]amino]butanoic acid (PubChem CID 91547279) has the molecular formula C27H31NO6S and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-[benzyl-[[3-[2-(3-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]amino]butanoic acid.
| Compound Name | 2-[benzyl-[[3-[2-(3-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 91547279 |
| Molecular Formula | C27H31NO6S |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[benzyl-[[3-[2-(3-methylsulfonyloxyphenyl)ethoxy]phenyl]methyl]amino]butanoic acid |
| SMILES | CCC(C(=O)O)N(Cc1ccccc1)Cc1cccc(OCCc2cccc(OS(C)(=O)=O)c2)c1 |
| InChI | InChI=1S/C27H31NO6S/c1-3-26(27(29)30)28(19-22-9-5-4-6-10-22)20-23-12-8-13-24(18-23)33-16-15-21-11-7-14-25(17-21)34-35(2,31)32/h4-14,17-18,26H,3,15-16,19-20H2,1-2H3,(H,29,30) |
| InChIKey | OYUJSNFUFUIVCT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|