C14H20ClNO4S — CID 7127056
[3-[[[(2R)-butan-2-yl]-(2-chloroacetyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 7127056) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(2-chloroacetyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(2-chloroacetyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 7127056 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(2-chloroacetyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1cccc(OS(C)(=O)=O)c1)C(=O)CCl |
| InChI | InChI=1S/C14H20ClNO4S/c1-4-11(2)16(14(17)9-15)10-12-6-5-7-13(8-12)20-21(3,18)19/h5-8,11H,4,9-10H2,1-3H3/t11-/m1/s1 |
| InChIKey | HXJLUPNWUDGXCY-LLVKDONJSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|