C15H23NO4S — CID 42775474
[3-[[butanoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42775474) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is [3-[[butanoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[butanoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42775474 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | [3-[[butanoyl(propan-2-yl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCCC(=O)N(Cc1cccc(OS(C)(=O)=O)c1)C(C)C |
| InChI | InChI=1S/C15H23NO4S/c1-5-7-15(17)16(12(2)3)11-13-8-6-9-14(10-13)20-21(4,18)19/h6,8-10,12H,5,7,11H2,1-4H3 |
| InChIKey | HCHUQLFASKCONC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|