C25H34FNO4S — CID 5169794
[3-[[nonanoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5169794) has the molecular formula C25H34FNO4S and a molecular weight of 463.62 g/mol. Its IUPAC name is [3-[[nonanoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[nonanoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5169794 |
| Molecular Formula | C25H34FNO4S |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | [3-[[nonanoyl(propan-2-yl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCCCCCCC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(C)C |
| InChI | InChI=1S/C25H34FNO4S/c1-4-5-6-7-8-9-13-25(28)27(20(2)3)19-21-11-10-12-23(18-21)31-32(29,30)24-16-14-22(26)15-17-24/h10-12,14-18,20H,4-9,13,19H2,1-3H3 |
| InChIKey | NUSQUGGNFXQSHJ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|