C20H25FN2O4S — CID 42775948
[3-[[butan-2-yl(dimethylcarbamoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 42775948) has the molecular formula C20H25FN2O4S and a molecular weight of 408.50 g/mol. Its IUPAC name is [3-[[butan-2-yl(dimethylcarbamoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[butan-2-yl(dimethylcarbamoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 42775948 |
| Molecular Formula | C20H25FN2O4S |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [3-[[butan-2-yl(dimethylcarbamoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)N(C)C |
| InChI | InChI=1S/C20H25FN2O4S/c1-5-15(2)23(20(24)22(3)4)14-16-7-6-8-18(13-16)27-28(25,26)19-11-9-17(21)10-12-19/h6-13,15H,5,14H2,1-4H3 |
| InChIKey | HNJRXXMITCXFLJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|