C24H23F2NO4S — CID 93010674
[3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 93010674) has the molecular formula C24H23F2NO4S and a molecular weight of 459.51 g/mol. Its IUPAC name is [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 93010674 |
| Molecular Formula | C24H23F2NO4S |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | [3-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC[C@@H](C)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H23F2NO4S/c1-3-17(2)27(24(28)22-9-4-5-10-23(22)26)16-18-7-6-8-20(15-18)31-32(29,30)21-13-11-19(25)12-14-21/h4-15,17H,3,16H2,1-2H3/t17-/m1/s1 |
| InChIKey | ANHQBRCYMWHFAZ-QGZVFWFLSA-N |
| XLogP | 5.17 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|