C24H21F4NO4S — CID 3576260
[3-[[(2-fluorobenzoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3576260) has the molecular formula C24H21F4NO4S and a molecular weight of 495.49 g/mol. Its IUPAC name is [3-[[(2-fluorobenzoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2-fluorobenzoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3576260 |
| Molecular Formula | C24H21F4NO4S |
| Molecular Weight | 495.49 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | [3-[[(2-fluorobenzoyl)-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)N(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H21F4NO4S/c1-16(2)29(23(30)21-11-3-4-12-22(21)25)15-17-7-5-9-19(13-17)33-34(31,32)20-10-6-8-18(14-20)24(26,27)28/h3-14,16H,15H2,1-2H3 |
| InChIKey | HSCCYYCXRYPKEG-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|