C26H27F3N2O4S — CID 4283759
[3-[[(3-ethylphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4283759) has the molecular formula C26H27F3N2O4S and a molecular weight of 520.57 g/mol. Its IUPAC name is [3-[[(3-ethylphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(3-ethylphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4283759 |
| Molecular Formula | C26H27F3N2O4S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [3-[[(3-ethylphenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CCc1cccc(NC(=O)N(Cc2cccc(OS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)C(C)C)c1 |
| InChI | InChI=1S/C26H27F3N2O4S/c1-4-19-8-5-11-22(14-19)30-25(32)31(18(2)3)17-20-9-6-12-23(15-20)35-36(33,34)24-13-7-10-21(16-24)26(27,28)29/h5-16,18H,4,17H2,1-3H3,(H,30,32) |
| InChIKey | UYXWACZPIOBFHL-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|