C27H23F3N2O5S — CID 42775535
[3-[[furan-2-ylmethyl-[(3-methylphenyl)carbamoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 42775535) has the molecular formula C27H23F3N2O5S and a molecular weight of 544.55 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl-[(3-methylphenyl)carbamoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl-[(3-methylphenyl)carbamoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 42775535 |
| Molecular Formula | C27H23F3N2O5S |
| Molecular Weight | 544.55 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | [3-[[furan-2-ylmethyl-[(3-methylphenyl)carbamoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1cccc(NC(=O)N(Cc2cccc(OS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)Cc2ccco2)c1 |
| InChI | InChI=1S/C27H23F3N2O5S/c1-19-6-2-9-22(14-19)31-26(33)32(18-24-11-5-13-36-24)17-20-7-3-10-23(15-20)37-38(34,35)25-12-4-8-21(16-25)27(28,29)30/h2-16H,17-18H2,1H3,(H,31,33) |
| InChIKey | ZQSBSYJPFDZMSW-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.55 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|