C29H28F3NO6S2 — CID 4196566
[3-[[(4-tert-butylphenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4196566) has the molecular formula C29H28F3NO6S2 and a molecular weight of 607.67 g/mol. Its IUPAC name is [3-[[(4-tert-butylphenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(4-tert-butylphenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4196566 |
| Molecular Formula | C29H28F3NO6S2 |
| Molecular Weight | 607.67 g/mol |
| Exact Mass | 607.13 |
| IUPAC Name | [3-[[(4-tert-butylphenyl)sulfonyl-(furan-2-ylmethyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N(Cc2cccc(OS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C29H28F3NO6S2/c1-28(2,3)22-12-14-26(15-13-22)40(34,35)33(20-25-10-6-16-38-25)19-21-7-4-9-24(17-21)39-41(36,37)27-11-5-8-23(18-27)29(30,31)32/h4-18H,19-20H2,1-3H3 |
| InChIKey | WONHDBPVFKJSQB-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|