C24H23F4NO5S2 — CID 4592422
[3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4592422) has the molecular formula C24H23F4NO5S2 and a molecular weight of 545.58 g/mol. Its IUPAC name is [3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4592422 |
| Molecular Formula | C24H23F4NO5S2 |
| Molecular Weight | 545.58 g/mol |
| Exact Mass | 545.10 |
| IUPAC Name | [3-[[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H23F4NO5S2/c1-17(2)15-29(35(30,31)22-11-9-20(25)10-12-22)16-18-5-3-7-21(13-18)34-36(32,33)23-8-4-6-19(14-23)24(26,27)28/h3-14,17H,15-16H2,1-2H3 |
| InChIKey | GGTSSHJARVMTRN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.58 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|