C29H26F3NO4S — CID 4258329
[3-[[2-methylpropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4258329) has the molecular formula C29H26F3NO4S and a molecular weight of 541.59 g/mol. Its IUPAC name is [3-[[2-methylpropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[2-methylpropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4258329 |
| Molecular Formula | C29H26F3NO4S |
| Molecular Weight | 541.59 g/mol |
| Exact Mass | 541.15 |
| IUPAC Name | [3-[[2-methylpropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C29H26F3NO4S/c1-20(2)18-33(28(34)27-15-6-10-22-9-3-4-14-26(22)27)19-21-8-5-12-24(16-21)37-38(35,36)25-13-7-11-23(17-25)29(30,31)32/h3-17,20H,18-19H2,1-2H3 |
| InChIKey | CFNFFWDOSQICBU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.59 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|