C32H30F3NO4S — CID 5019156
[3-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 5019156) has the molecular formula C32H30F3NO4S and a molecular weight of 581.66 g/mol. Its IUPAC name is [3-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 5019156 |
| Molecular Formula | C32H30F3NO4S |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | [3-[[(2,2-diphenylacetyl)-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)c1)C(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H30F3NO4S/c1-23(2)21-36(31(37)30(25-12-5-3-6-13-25)26-14-7-4-8-15-26)22-24-11-9-17-28(19-24)40-41(38,39)29-18-10-16-27(20-29)32(33,34)35/h3-20,23,30H,21-22H2,1-2H3 |
| InChIKey | DFZBBWCJLXDUMI-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|