C27H29F3N2O4S — CID 4113114
[3-[[(3,4-dimethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4113114) has the molecular formula C27H29F3N2O4S and a molecular weight of 534.60 g/mol. Its IUPAC name is [3-[[(3,4-dimethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [3-[[(3,4-dimethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4113114 |
| Molecular Formula | C27H29F3N2O4S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | [3-[[(3,4-dimethylphenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1ccc(NC(=O)N(Cc2cccc(OS(=O)(=O)c3cccc(C(F)(F)F)c3)c2)CC(C)C)cc1C |
| InChI | InChI=1S/C27H29F3N2O4S/c1-18(2)16-32(26(33)31-23-12-11-19(3)20(4)13-23)17-21-7-5-9-24(14-21)36-37(34,35)25-10-6-8-22(15-25)27(28,29)30/h5-15,18H,16-17H2,1-4H3,(H,31,33) |
| InChIKey | QPCLYPZKPOVZGP-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|