C24H24F2N2O4S — CID 5047777
[3-[[(3-fluorophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5047777) has the molecular formula C24H24F2N2O4S and a molecular weight of 474.53 g/mol. Its IUPAC name is [3-[[(3-fluorophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(3-fluorophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5047777 |
| Molecular Formula | C24H24F2N2O4S |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | [3-[[(3-fluorophenyl)carbamoyl-(2-methylpropyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)CN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C24H24F2N2O4S/c1-17(2)15-28(24(29)27-21-7-4-6-20(26)14-21)16-18-5-3-8-22(13-18)32-33(30,31)23-11-9-19(25)10-12-23/h3-14,17H,15-16H2,1-2H3,(H,27,29) |
| InChIKey | ODYLZRUULJOFGJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|