C20H25NO5S — CID 42811393
[3-[[acetyl(2-methylpropyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 42811393) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is [3-[[acetyl(2-methylpropyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[acetyl(2-methylpropyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 42811393 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [3-[[acetyl(2-methylpropyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(CC(C)C)C(C)=O)c2)cc1 |
| InChI | InChI=1S/C20H25NO5S/c1-15(2)13-21(16(3)22)14-17-6-5-7-19(12-17)26-27(23,24)20-10-8-18(25-4)9-11-20/h5-12,15H,13-14H2,1-4H3 |
| InChIKey | CXXSZNKCVDMQLE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|