C24H31NO6S — CID 93301793
[3-[[3-methylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 93301793) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is [3-[[3-methylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[3-methylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 93301793 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [3-[[3-methylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(C[C@@H]3CCCO3)C(=O)CC(C)C)c2)cc1 |
| InChI | InChI=1S/C24H31NO6S/c1-18(2)14-24(26)25(17-22-8-5-13-30-22)16-19-6-4-7-21(15-19)31-32(27,28)23-11-9-20(29-3)10-12-23/h4,6-7,9-12,15,18,22H,5,8,13-14,16-17H2,1-3H3/t22-/m0/s1 |
| InChIKey | ITCNMOCLHMXIGP-QFIPXVFZSA-N |
| XLogP | 4.02 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|