C24H25NO6S2 — CID 93301765
[3-[[[(2S)-oxolan-2-yl]methyl-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 93301765) has the molecular formula C24H25NO6S2 and a molecular weight of 487.60 g/mol. Its IUPAC name is [3-[[[(2S)-oxolan-2-yl]methyl-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[[(2S)-oxolan-2-yl]methyl-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 93301765 |
| Molecular Formula | C24H25NO6S2 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.11 |
| IUPAC Name | [3-[[[(2S)-oxolan-2-yl]methyl-(thiophene-2-carbonyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(C[C@@H]3CCCO3)C(=O)c3cccs3)c2)cc1 |
| InChI | InChI=1S/C24H25NO6S2/c1-29-19-9-11-22(12-10-19)33(27,28)31-20-6-2-5-18(15-20)16-25(17-21-7-3-13-30-21)24(26)23-8-4-14-32-23/h2,4-6,8-12,14-15,21H,3,7,13,16-17H2,1H3/t21-/m0/s1 |
| InChIKey | DBNOETQANYZVBT-NRFANRHFSA-N |
| XLogP | 4.35 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|