C22H20FNO4S2 — CID 71955473
[3-[[cyclopropylmethyl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 71955473) has the molecular formula C22H20FNO4S2 and a molecular weight of 445.54 g/mol. Its IUPAC name is [3-[[cyclopropylmethyl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclopropylmethyl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 71955473 |
| Molecular Formula | C22H20FNO4S2 |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | [3-[[cyclopropylmethyl(thiophene-2-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(c1cccs1)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)CC1CC1 |
| InChI | InChI=1S/C22H20FNO4S2/c23-18-8-10-20(11-9-18)30(26,27)28-19-4-1-3-17(13-19)15-24(14-16-6-7-16)22(25)21-5-2-12-29-21/h1-5,8-13,16H,6-7,14-15H2 |
| InChIKey | KYEVMAOHJOEFJQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|