C24H22FNO5S — CID 46110901
[3-[[cyclopropyl-(2-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46110901) has the molecular formula C24H22FNO5S and a molecular weight of 455.51 g/mol. Its IUPAC name is [3-[[cyclopropyl-(2-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclopropyl-(2-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46110901 |
| Molecular Formula | C24H22FNO5S |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [3-[[cyclopropyl-(2-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccccc1C(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C1CC1 |
| InChI | InChI=1S/C24H22FNO5S/c1-30-23-8-3-2-7-22(23)24(27)26(19-11-12-19)16-17-5-4-6-20(15-17)31-32(28,29)21-13-9-18(25)10-14-21/h2-10,13-15,19H,11-12,16H2,1H3 |
| InChIKey | KIGWSHNMYLFPGV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|