C27H22FNO4S — CID 46110924
[4-[[cyclopropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46110924) has the molecular formula C27H22FNO4S and a molecular weight of 475.54 g/mol. Its IUPAC name is [4-[[cyclopropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[cyclopropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46110924 |
| Molecular Formula | C27H22FNO4S |
| Molecular Weight | 475.54 g/mol |
| Exact Mass | 475.13 |
| IUPAC Name | [4-[[cyclopropyl(naphthalene-1-carbonyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(c1cccc2ccccc12)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C27H22FNO4S/c28-21-10-16-24(17-11-21)34(31,32)33-23-14-8-19(9-15-23)18-29(22-12-13-22)27(30)26-7-3-5-20-4-1-2-6-25(20)26/h1-11,14-17,22H,12-13,18H2 |
| InChIKey | AOSUILSMJSKLRD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|