C34H27F2NO4S — CID 4029221
[4-[[(2,2-diphenylacetyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4029221) has the molecular formula C34H27F2NO4S and a molecular weight of 583.66 g/mol. Its IUPAC name is [4-[[(2,2-diphenylacetyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(2,2-diphenylacetyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4029221 |
| Molecular Formula | C34H27F2NO4S |
| Molecular Weight | 583.66 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | [4-[[(2,2-diphenylacetyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N(Cc1ccc(F)cc1)Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C34H27F2NO4S/c35-29-15-11-25(12-16-29)23-37(34(38)33(27-7-3-1-4-8-27)28-9-5-2-6-10-28)24-26-13-19-31(20-14-26)41-42(39,40)32-21-17-30(36)18-22-32/h1-22,33H,23-24H2 |
| InChIKey | MEBXTKVPUKAYHZ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.66 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|