C25H25F2NO4S — CID 3963553
[4-[[(4-fluorophenyl)methyl-pentanoylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3963553) has the molecular formula C25H25F2NO4S and a molecular weight of 473.54 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)methyl-pentanoylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)methyl-pentanoylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3963553 |
| Molecular Formula | C25H25F2NO4S |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | [4-[[(4-fluorophenyl)methyl-pentanoylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCCC(=O)N(Cc1ccc(F)cc1)Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C25H25F2NO4S/c1-2-3-4-25(29)28(17-19-5-9-21(26)10-6-19)18-20-7-13-23(14-8-20)32-33(30,31)24-15-11-22(27)12-16-24/h5-16H,2-4,17-18H2,1H3 |
| InChIKey | UWUSKJYIBYVRMO-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|