C29H26F2N2O5S — CID 3260898
[4-[[(4-ethoxyphenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3260898) has the molecular formula C29H26F2N2O5S and a molecular weight of 552.60 g/mol. Its IUPAC name is [4-[[(4-ethoxyphenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(4-ethoxyphenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3260898 |
| Molecular Formula | C29H26F2N2O5S |
| Molecular Weight | 552.60 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | [4-[[(4-ethoxyphenyl)carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCOc1ccc(NC(=O)N(Cc2ccc(F)cc2)Cc2ccc(OS(=O)(=O)c3ccc(F)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H26F2N2O5S/c1-2-37-26-15-11-25(12-16-26)32-29(34)33(19-21-3-7-23(30)8-4-21)20-22-5-13-27(14-6-22)38-39(35,36)28-17-9-24(31)10-18-28/h3-18H,2,19-20H2,1H3,(H,32,34) |
| InChIKey | IVSKBULRQJZKAP-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|