C33H34F2N2O4S — CID 5177611
[4-[[[2,6-di(propan-2-yl)phenyl]carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5177611) has the molecular formula C33H34F2N2O4S and a molecular weight of 592.71 g/mol. Its IUPAC name is [4-[[[2,6-di(propan-2-yl)phenyl]carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[[2,6-di(propan-2-yl)phenyl]carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5177611 |
| Molecular Formula | C33H34F2N2O4S |
| Molecular Weight | 592.71 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [4-[[[2,6-di(propan-2-yl)phenyl]carbamoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)N(Cc1ccc(F)cc1)Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C33H34F2N2O4S/c1-22(2)30-6-5-7-31(23(3)4)32(30)36-33(38)37(20-24-8-12-26(34)13-9-24)21-25-10-16-28(17-11-25)41-42(39,40)29-18-14-27(35)15-19-29/h5-19,22-23H,20-21H2,1-4H3,(H,36,38) |
| InChIKey | OOJTUTXLVUNDQU-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.71 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|