C23H22BrFN2O4S — CID 3275288
[4-[[(4-bromophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3275288) has the molecular formula C23H22BrFN2O4S and a molecular weight of 521.41 g/mol. Its IUPAC name is [4-[[(4-bromophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(4-bromophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3275288 |
| Molecular Formula | C23H22BrFN2O4S |
| Molecular Weight | 521.41 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | [4-[[(4-bromophenyl)carbamoyl-propan-2-ylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H22BrFN2O4S/c1-16(2)27(23(28)26-20-9-5-18(24)6-10-20)15-17-3-11-21(12-4-17)31-32(29,30)22-13-7-19(25)8-14-22/h3-14,16H,15H2,1-2H3,(H,26,28) |
| InChIKey | PINFGUNNZRFNLT-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|