C24H23FN2O4S — CID 46111196
[4-[[cyclopropyl-[(4-methylphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 46111196) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is [4-[[cyclopropyl-[(4-methylphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[cyclopropyl-[(4-methylphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 46111196 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [4-[[cyclopropyl-[(4-methylphenyl)carbamoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | Cc1ccc(NC(=O)N(Cc2ccc(OS(=O)(=O)c3ccc(F)cc3)cc2)C2CC2)cc1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-17-2-8-20(9-3-17)26-24(28)27(21-10-11-21)16-18-4-12-22(13-5-18)31-32(29,30)23-14-6-19(25)7-15-23/h2-9,12-15,21H,10-11,16H2,1H3,(H,26,28) |
| InChIKey | OBIULDOTLYPRMH-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|