C25H32FNO4S — CID 93019384
[4-[[cyclopropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 93019384) has the molecular formula C25H32FNO4S and a molecular weight of 461.60 g/mol. Its IUPAC name is [4-[[cyclopropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[cyclopropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 93019384 |
| Molecular Formula | C25H32FNO4S |
| Molecular Weight | 461.60 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | [4-[[cyclopropyl-[(3S)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | C[C@H](CC(=O)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C1CC1)CC(C)(C)C |
| InChI | InChI=1S/C25H32FNO4S/c1-18(16-25(2,3)4)15-24(28)27(21-9-10-21)17-19-5-11-22(12-6-19)31-32(29,30)23-13-7-20(26)8-14-23/h5-8,11-14,18,21H,9-10,15-17H2,1-4H3/t18-/m1/s1 |
| InChIKey | FLAGAHPWQLNFHZ-GOSISDBHSA-N |
| XLogP | 5.55 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.60 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|