C25H34FNO5S — CID 92519045
[3-[[2-methoxyethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 92519045) has the molecular formula C25H34FNO5S and a molecular weight of 479.61 g/mol. Its IUPAC name is [3-[[2-methoxyethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[2-methoxyethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 92519045 |
| Molecular Formula | C25H34FNO5S |
| Molecular Weight | 479.61 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | [3-[[2-methoxyethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)C[C@H](C)CC(C)(C)C |
| InChI | InChI=1S/C25H34FNO5S/c1-19(17-25(2,3)4)15-24(28)27(13-14-31-5)18-20-7-6-8-22(16-20)32-33(29,30)23-11-9-21(26)10-12-23/h6-12,16,19H,13-15,17-18H2,1-5H3/t19-/m0/s1 |
| InChIKey | FWGCFXASLYMZDK-IBGZPJMESA-N |
| XLogP | 5.03 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.61 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|