C23H21ClFNO5S — CID 42664933
[3-[[(3-chlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 42664933) has the molecular formula C23H21ClFNO5S and a molecular weight of 477.94 g/mol. Its IUPAC name is [3-[[(3-chlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[(3-chlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 42664933 |
| Molecular Formula | C23H21ClFNO5S |
| Molecular Weight | 477.94 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | [3-[[(3-chlorobenzoyl)-(2-methoxyethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C23H21ClFNO5S/c1-30-13-12-26(23(27)18-5-3-6-19(24)15-18)16-17-4-2-7-21(14-17)31-32(28,29)22-10-8-20(25)9-11-22/h2-11,14-15H,12-13,16H2,1H3 |
| InChIKey | KQKBZHIAMMJRMM-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|