C27H21F2NO4S — CID 3619943
[3-[[benzoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3619943) has the molecular formula C27H21F2NO4S and a molecular weight of 493.53 g/mol. Its IUPAC name is [3-[[benzoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[benzoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3619943 |
| Molecular Formula | C27H21F2NO4S |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | [3-[[benzoyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(c1ccccc1)N(Cc1ccc(F)cc1)Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C27H21F2NO4S/c28-23-11-9-20(10-12-23)18-30(27(31)22-6-2-1-3-7-22)19-21-5-4-8-25(17-21)34-35(32,33)26-15-13-24(29)14-16-26/h1-17H,18-19H2 |
| InChIKey | SYUNHMHIMXUKFW-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|