C25H23F2NO4S — CID 71955458
[3-[[cyclobutanecarbonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 71955458) has the molecular formula C25H23F2NO4S and a molecular weight of 471.53 g/mol. Its IUPAC name is [3-[[cyclobutanecarbonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclobutanecarbonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 71955458 |
| Molecular Formula | C25H23F2NO4S |
| Molecular Weight | 471.53 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [3-[[cyclobutanecarbonyl-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(C1CCC1)N(Cc1ccc(F)cc1)Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C25H23F2NO4S/c26-21-9-7-18(8-10-21)16-28(25(29)20-4-2-5-20)17-19-3-1-6-23(15-19)32-33(30,31)24-13-11-22(27)12-14-24/h1,3,6-15,20H,2,4-5,16-17H2 |
| InChIKey | SZDZBOLJPDLXMI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.53 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|