C22H20FNO5S — CID 4245890
[3-[[cyclopropanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4245890) has the molecular formula C22H20FNO5S and a molecular weight of 429.47 g/mol. Its IUPAC name is [3-[[cyclopropanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[cyclopropanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4245890 |
| Molecular Formula | C22H20FNO5S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | [3-[[cyclopropanecarbonyl(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(C1CC1)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)Cc1ccco1 |
| InChI | InChI=1S/C22H20FNO5S/c23-18-8-10-21(11-9-18)30(26,27)29-19-4-1-3-16(13-19)14-24(22(25)17-6-7-17)15-20-5-2-12-28-20/h1-5,8-13,17H,6-7,14-15H2 |
| InChIKey | BHNDFNRBIDHYJM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|