C21H20FNO5S — CID 5179986
[3-[[furan-2-ylmethyl(propanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5179986) has the molecular formula C21H20FNO5S and a molecular weight of 417.46 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl(propanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl(propanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5179986 |
| Molecular Formula | C21H20FNO5S |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | [3-[[furan-2-ylmethyl(propanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)Cc1ccco1 |
| InChI | InChI=1S/C21H20FNO5S/c1-2-21(24)23(15-19-7-4-12-27-19)14-16-5-3-6-18(13-16)28-29(25,26)20-10-8-17(22)9-11-20/h3-13H,2,14-15H2,1H3 |
| InChIKey | HQLLDYBOQLNAQW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|