C23H25NO6S — CID 46135191
[3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 46135191) has the molecular formula C23H25NO6S and a molecular weight of 443.52 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 46135191 |
| Molecular Formula | C23H25NO6S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | [3-[[furan-2-ylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(Cc3ccco3)C(=O)C(C)C)c2)cc1 |
| InChI | InChI=1S/C23H25NO6S/c1-17(2)23(25)24(16-21-8-5-13-29-21)15-18-6-4-7-20(14-18)30-31(26,27)22-11-9-19(28-3)10-12-22/h4-14,17H,15-16H2,1-3H3 |
| InChIKey | WAGPLPOVFOFJOY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|