C16H18ClNO5S — CID 3496529
[3-[[2-chloropropanoyl(furan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 3496529) has the molecular formula C16H18ClNO5S and a molecular weight of 371.84 g/mol. Its IUPAC name is [3-[[2-chloropropanoyl(furan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[2-chloropropanoyl(furan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3496529 |
| Molecular Formula | C16H18ClNO5S |
| Molecular Weight | 371.84 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | [3-[[2-chloropropanoyl(furan-2-ylmethyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CC(Cl)C(=O)N(Cc1cccc(OS(C)(=O)=O)c1)Cc1ccco1 |
| InChI | InChI=1S/C16H18ClNO5S/c1-12(17)16(19)18(11-15-7-4-8-22-15)10-13-5-3-6-14(9-13)23-24(2,20)21/h3-9,12H,10-11H2,1-2H3 |
| InChIKey | DQYSSMBNIOWRSG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.84 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|