C24H21NO5S — CID 42775438
[3-[[furan-2-ylmethyl(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 42775438) has the molecular formula C24H21NO5S and a molecular weight of 435.50 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 42775438 |
| Molecular Formula | C24H21NO5S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | [3-[[furan-2-ylmethyl(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1cccc(CN(Cc2ccco2)C(=O)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C24H21NO5S/c1-31(27,28)30-20-10-4-7-18(15-20)16-25(17-21-11-6-14-29-21)24(26)23-13-5-9-19-8-2-3-12-22(19)23/h2-15H,16-17H2,1H3 |
| InChIKey | HPZOAZJOEQZIAD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|