C26H22FNO4S — CID 4214395
[4-[[(4-fluorophenyl)methyl-(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4214395) has the molecular formula C26H22FNO4S and a molecular weight of 463.53 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)methyl-(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)methyl-(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4214395 |
| Molecular Formula | C26H22FNO4S |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | [4-[[(4-fluorophenyl)methyl-(naphthalene-1-carbonyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(CN(Cc2ccc(F)cc2)C(=O)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C26H22FNO4S/c1-33(30,31)32-23-15-11-20(12-16-23)18-28(17-19-9-13-22(27)14-10-19)26(29)25-8-4-6-21-5-2-3-7-24(21)25/h2-16H,17-18H2,1H3 |
| InChIKey | FWTCNPRMQXIGKL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|