C26H22FNO6S — CID 4667822
[3-[[furan-2-ylmethyl-(4-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 4667822) has the molecular formula C26H22FNO6S and a molecular weight of 495.53 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl-(4-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl-(4-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 4667822 |
| Molecular Formula | C26H22FNO6S |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.12 |
| IUPAC Name | [3-[[furan-2-ylmethyl-(4-methoxybenzoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COc1ccc(C(=O)N(Cc2cccc(OS(=O)(=O)c3ccc(F)cc3)c2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C26H22FNO6S/c1-32-22-11-7-20(8-12-22)26(29)28(18-24-6-3-15-33-24)17-19-4-2-5-23(16-19)34-35(30,31)25-13-9-21(27)10-14-25/h2-16H,17-18H2,1H3 |
| InChIKey | YALLFYGFHSEBLI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|