C22H23FN2O6S — CID 71956720
[3-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate (PubChem CID 71956720) has the molecular formula C22H23FN2O6S and a molecular weight of 462.50 g/mol. Its IUPAC name is [3-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate.
| Compound Name | [3-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 71956720 |
| Molecular Formula | C22H23FN2O6S |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | [3-[[ethylcarbamoyl(furan-2-ylmethyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate |
| SMILES | CCNC(=O)N(Cc1cccc(OS(=O)(=O)c2ccc(OC)c(F)c2)c1)Cc1ccco1 |
| InChI | InChI=1S/C22H23FN2O6S/c1-3-24-22(26)25(15-18-8-5-11-30-18)14-16-6-4-7-17(12-16)31-32(27,28)19-9-10-21(29-2)20(23)13-19/h4-13H,3,14-15H2,1-2H3,(H,24,26) |
| InChIKey | WHCGQEFQCODUIN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|