C24H33FN2O5S — CID 83283083
[3-[[2-(dimethylamino)ethyl-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate (PubChem CID 83283083) has the molecular formula C24H33FN2O5S and a molecular weight of 480.60 g/mol. Its IUPAC name is [3-[[2-(dimethylamino)ethyl-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate.
| Compound Name | [3-[[2-(dimethylamino)ethyl-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 83283083 |
| Molecular Formula | C24H33FN2O5S |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | [3-[[2-(dimethylamino)ethyl-(3,3-dimethylbutanoyl)amino]methyl]phenyl] 3-fluoro-4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(CCN(C)C)C(=O)CC(C)(C)C)c2)cc1F |
| InChI | InChI=1S/C24H33FN2O5S/c1-24(2,3)16-23(28)27(13-12-26(4)5)17-18-8-7-9-19(14-18)32-33(29,30)20-10-11-22(31-6)21(25)15-20/h7-11,14-15H,12-13,16-17H2,1-6H3 |
| InChIKey | MUESEYZXLQJGJA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|