C25H33NO6S — CID 93301795
[3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 93301795) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is [3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 93301795 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [3-[[3,3-dimethylbutanoyl-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(CN(C[C@@H]3CCCO3)C(=O)CC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C25H33NO6S/c1-25(2,3)16-24(27)26(18-22-9-6-14-31-22)17-19-7-5-8-21(15-19)32-33(28,29)23-12-10-20(30-4)11-13-23/h5,7-8,10-13,15,22H,6,9,14,16-18H2,1-4H3/t22-/m0/s1 |
| InChIKey | FXEYYUZMVKQKIA-QFIPXVFZSA-N |
| XLogP | 4.41 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|