C24H31NO5S — CID 71956821
[2-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 71956821) has the molecular formula C24H31NO5S and a molecular weight of 445.58 g/mol. Its IUPAC name is [2-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [2-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 71956821 |
| Molecular Formula | C24H31NO5S |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | [2-[[cyclopropylmethyl(3,3-dimethylbutanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccccc2CN(CC2CC2)C(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31NO5S/c1-24(2,3)15-23(26)25(16-18-9-10-18)17-19-7-5-6-8-22(19)30-31(27,28)21-13-11-20(29-4)12-14-21/h5-8,11-14,18H,9-10,15-17H2,1-4H3 |
| InChIKey | AVRKCXVEKUBGME-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|