C22H27NO5S — CID 71956830
[2-[[cyclopropylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 71956830) has the molecular formula C22H27NO5S and a molecular weight of 417.53 g/mol. Its IUPAC name is [2-[[cyclopropylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [2-[[cyclopropylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 71956830 |
| Molecular Formula | C22H27NO5S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [2-[[cyclopropylmethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2ccccc2CN(CC2CC2)C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C22H27NO5S/c1-16(2)22(24)23(14-17-8-9-17)15-18-6-4-5-7-21(18)28-29(25,26)20-12-10-19(27-3)11-13-20/h4-7,10-13,16-17H,8-9,14-15H2,1-3H3 |
| InChIKey | BCIFOTVAQSOQIE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|