C22H29NO7S — CID 46135356
[2-methoxy-5-[[2-methoxyethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 46135356) has the molecular formula C22H29NO7S and a molecular weight of 451.54 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 46135356 |
| Molecular Formula | C22H29NO7S |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl(2-methylpropanoyl)amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(=O)(=O)c2ccc(OC)cc2)c1)C(=O)C(C)C |
| InChI | InChI=1S/C22H29NO7S/c1-16(2)22(24)23(12-13-27-3)15-17-6-11-20(29-5)21(14-17)30-31(25,26)19-9-7-18(28-4)8-10-19/h6-11,14,16H,12-13,15H2,1-5H3 |
| InChIKey | AXFNBDBMHXKYOY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|